C28H24FNO2 — CID 163789758
4-[2-[(2-fluoro-4-methylphenyl)methyl]-6-(2-oxobut-3-enyl)phenyl]-2-methylisoquinolin-1-one (PubChem CID 163789758) has the molecular formula C28H24FNO2 and a molecular weight of 425.50 g/mol. Its IUPAC name is 4-[2-[(2-fluoro-4-methylphenyl)methyl]-6-(2-oxobut-3-enyl)phenyl]-2-methylisoquinolin-1-one.
| Compound Name | 4-[2-[(2-fluoro-4-methylphenyl)methyl]-6-(2-oxobut-3-enyl)phenyl]-2-methylisoquinolin-1-one |
|---|---|
| PubChem CID | 163789758 |
| Molecular Formula | C28H24FNO2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 4-[2-[(2-fluoro-4-methylphenyl)methyl]-6-(2-oxobut-3-enyl)phenyl]-2-methylisoquinolin-1-one |
| SMILES | C=CC(=O)Cc1cccc(Cc2ccc(C)cc2F)c1-c1cn(C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C28H24FNO2/c1-4-22(31)16-21-9-7-8-20(15-19-13-12-18(2)14-26(19)29)27(21)25-17-30(3)28(32)24-11-6-5-10-23(24)25/h4-14,17H,1,15-16H2,2-3H3 |
| InChIKey | LLLOIKYSNJHFTM-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|