C27H22FNO2 — CID 149330749
4-[2-[(4-fluorophenyl)methyl]-6-(2-oxobut-3-enyl)phenyl]-2-methylisoquinolin-1-one (PubChem CID 149330749) has the molecular formula C27H22FNO2 and a molecular weight of 411.48 g/mol. Its IUPAC name is 4-[2-[(4-fluorophenyl)methyl]-6-(2-oxobut-3-enyl)phenyl]-2-methylisoquinolin-1-one.
| Compound Name | 4-[2-[(4-fluorophenyl)methyl]-6-(2-oxobut-3-enyl)phenyl]-2-methylisoquinolin-1-one |
|---|---|
| PubChem CID | 149330749 |
| Molecular Formula | C27H22FNO2 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 4-[2-[(4-fluorophenyl)methyl]-6-(2-oxobut-3-enyl)phenyl]-2-methylisoquinolin-1-one |
| SMILES | C=CC(=O)Cc1cccc(Cc2ccc(F)cc2)c1-c1cn(C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C27H22FNO2/c1-3-22(30)16-20-8-6-7-19(15-18-11-13-21(28)14-12-18)26(20)25-17-29(2)27(31)24-10-5-4-9-23(24)25/h3-14,17H,1,15-16H2,2H3 |
| InChIKey | YCGJAJABRQQHMM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|