C23H20F2N2O3 — CID 159835166
6-[2-(2,4-difluorophenoxy)-6-(2-oxobut-3-enyl)phenyl]-4-ethyl-2-methylpyridazin-3-one (PubChem CID 159835166) has the molecular formula C23H20F2N2O3 and a molecular weight of 410.42 g/mol. Its IUPAC name is 6-[2-(2,4-difluorophenoxy)-6-(2-oxobut-3-enyl)phenyl]-4-ethyl-2-methylpyridazin-3-one.
| Compound Name | 6-[2-(2,4-difluorophenoxy)-6-(2-oxobut-3-enyl)phenyl]-4-ethyl-2-methylpyridazin-3-one |
|---|---|
| PubChem CID | 159835166 |
| Molecular Formula | C23H20F2N2O3 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 6-[2-(2,4-difluorophenoxy)-6-(2-oxobut-3-enyl)phenyl]-4-ethyl-2-methylpyridazin-3-one |
| SMILES | C=CC(=O)Cc1cccc(Oc2ccc(F)cc2F)c1-c1cc(CC)c(=O)n(C)n1 |
| InChI | InChI=1S/C23H20F2N2O3/c1-4-14-12-19(26-27(3)23(14)29)22-15(11-17(28)5-2)7-6-8-21(22)30-20-10-9-16(24)13-18(20)25/h5-10,12-13H,2,4,11H2,1,3H3 |
| InChIKey | NNYYYCRXOVAOHM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|