C28H24N4O2 — CID 146575699
N-[3-(7-cyano-2-methyl-1-oxoisoquinolin-4-yl)-4-(2,6-dimethylanilino)phenyl]prop-2-enamide (PubChem CID 146575699) has the molecular formula C28H24N4O2 and a molecular weight of 448.53 g/mol. Its IUPAC name is N-[3-(7-cyano-2-methyl-1-oxoisoquinolin-4-yl)-4-(2,6-dimethylanilino)phenyl]prop-2-enamide.
| Compound Name | N-[3-(7-cyano-2-methyl-1-oxoisoquinolin-4-yl)-4-(2,6-dimethylanilino)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146575699 |
| Molecular Formula | C28H24N4O2 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | N-[3-(7-cyano-2-methyl-1-oxoisoquinolin-4-yl)-4-(2,6-dimethylanilino)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(Nc2c(C)cccc2C)c(-c2cn(C)c(=O)c3cc(C#N)ccc23)c1 |
| InChI | InChI=1S/C28H24N4O2/c1-5-26(33)30-20-10-12-25(31-27-17(2)7-6-8-18(27)3)22(14-20)24-16-32(4)28(34)23-13-19(15-29)9-11-21(23)24/h5-14,16,31H,1H2,2-4H3,(H,30,33) |
| InChIKey | NQIJCFLPWRLWMC-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 86.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|