C22H21ClN4O2 — CID 146575637
N-[4-(4-chloroanilino)-3-[1-methyl-5-(methylamino)-6-oxo-3-pyridinyl]phenyl]prop-2-enamide (PubChem CID 146575637) has the molecular formula C22H21ClN4O2 and a molecular weight of 408.89 g/mol. Its IUPAC name is N-[4-(4-chloroanilino)-3-[1-methyl-5-(methylamino)-6-oxo-3-pyridinyl]phenyl]prop-2-enamide.
| Compound Name | N-[4-(4-chloroanilino)-3-[1-methyl-5-(methylamino)-6-oxo-3-pyridinyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 146575637 |
| Molecular Formula | C22H21ClN4O2 |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-[4-(4-chloroanilino)-3-[1-methyl-5-(methylamino)-6-oxo-3-pyridinyl]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(Nc2ccc(Cl)cc2)c(-c2cc(NC)c(=O)n(C)c2)c1 |
| InChI | InChI=1S/C22H21ClN4O2/c1-4-21(28)26-17-9-10-19(25-16-7-5-15(23)6-8-16)18(12-17)14-11-20(24-2)22(29)27(3)13-14/h4-13,24-25H,1H2,2-3H3,(H,26,28) |
| InChIKey | TZHKONLMTBGHLJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 75.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|