C10H9NO2 — CID 130610488
N-(2-hydroxy-6-methylphenyl)prop-2-ynamide (PubChem CID 130610488) has the molecular formula C10H9NO2 and a molecular weight of 175.19 g/mol. Its IUPAC name is N-(2-hydroxy-6-methylphenyl)prop-2-ynamide.
| Compound Name | N-(2-hydroxy-6-methylphenyl)prop-2-ynamide |
|---|---|
| PubChem CID | 130610488 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | N-(2-hydroxy-6-methylphenyl)prop-2-ynamide |
| SMILES | C#CC(=O)Nc1c(C)cccc1O |
| InChI | InChI=1S/C10H9NO2/c1-3-9(13)11-10-7(2)5-4-6-8(10)12/h1,4-6,12H,2H3,(H,11,13) |
| InChIKey | HHBPTXPUNCDNOD-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|