C17H12F5N3O2 — CID 66888732
3-[1-[(2,4-difluorophenyl)methyl]-6-(trifluoromethyl)-7H-pyrazolo[3,4-c]pyridin-3-yl]prop-2-enoic acid (PubChem CID 66888732) has the molecular formula C17H12F5N3O2 and a molecular weight of 385.29 g/mol. Its IUPAC name is 3-[1-[(2,4-difluorophenyl)methyl]-6-(trifluoromethyl)-7H-pyrazolo[3,4-c]pyridin-3-yl]prop-2-enoic acid.
| Compound Name | 3-[1-[(2,4-difluorophenyl)methyl]-6-(trifluoromethyl)-7H-pyrazolo[3,4-c]pyridin-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66888732 |
| Molecular Formula | C17H12F5N3O2 |
| Molecular Weight | 385.29 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 3-[1-[(2,4-difluorophenyl)methyl]-6-(trifluoromethyl)-7H-pyrazolo[3,4-c]pyridin-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1nn(Cc2ccc(F)cc2F)c2c1C=CN(C(F)(F)F)C2 |
| InChI | InChI=1S/C17H12F5N3O2/c18-11-2-1-10(13(19)7-11)8-25-15-9-24(17(20,21)22)6-5-12(15)14(23-25)3-4-16(26)27/h1-7H,8-9H2,(H,26,27) |
| InChIKey | OBOUNRCLPMBYRM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|