C11H8F2N2O2 — CID 55045761
1-[(2,4-difluorophenyl)methyl]pyrazole-4-carboxylic acid (PubChem CID 55045761) has the molecular formula C11H8F2N2O2 and a molecular weight of 238.19 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 55045761 |
| Molecular Formula | C11H8F2N2O2 |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnn(Cc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C11H8F2N2O2/c12-9-2-1-7(10(13)3-9)5-15-6-8(4-14-15)11(16)17/h1-4,6H,5H2,(H,16,17) |
| InChIKey | LYPQAEMRHGOHRS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |