C17H12F2O4 — CID 22613056
4-[3-[(2,4-difluorophenyl)methyl]phenyl]-2,4-dioxobutanoic acid (PubChem CID 22613056) has the molecular formula C17H12F2O4 and a molecular weight of 318.28 g/mol. Its IUPAC name is 4-[3-[(2,4-difluorophenyl)methyl]phenyl]-2,4-dioxobutanoic acid.
| Compound Name | 4-[3-[(2,4-difluorophenyl)methyl]phenyl]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 22613056 |
| Molecular Formula | C17H12F2O4 |
| Molecular Weight | 318.28 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 4-[3-[(2,4-difluorophenyl)methyl]phenyl]-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1cccc(Cc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C17H12F2O4/c18-13-5-4-11(14(19)8-13)6-10-2-1-3-12(7-10)15(20)9-16(21)17(22)23/h1-5,7-8H,6,9H2,(H,22,23) |
| InChIKey | BOZGGWBERIAIQB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|