C18H13F3O4 — CID 22613120
2,4-dioxo-4-[3-[[2-(trifluoromethyl)phenyl]methyl]phenyl]butanoic acid (PubChem CID 22613120) has the molecular formula C18H13F3O4 and a molecular weight of 350.29 g/mol. Its IUPAC name is 2,4-dioxo-4-[3-[[2-(trifluoromethyl)phenyl]methyl]phenyl]butanoic acid.
| Compound Name | 2,4-dioxo-4-[3-[[2-(trifluoromethyl)phenyl]methyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 22613120 |
| Molecular Formula | C18H13F3O4 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 2,4-dioxo-4-[3-[[2-(trifluoromethyl)phenyl]methyl]phenyl]butanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1cccc(Cc2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C18H13F3O4/c19-18(20,21)14-7-2-1-5-12(14)8-11-4-3-6-13(9-11)15(22)10-16(23)17(24)25/h1-7,9H,8,10H2,(H,24,25) |
| InChIKey | RBLYGGVGMYEEPN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|