C17H9F5O4 — CID 22613104
2,4-dioxo-4-[3-[(2,3,4,5,6-pentafluorophenyl)methyl]phenyl]butanoic acid (PubChem CID 22613104) has the molecular formula C17H9F5O4 and a molecular weight of 372.25 g/mol. Its IUPAC name is 2,4-dioxo-4-[3-[(2,3,4,5,6-pentafluorophenyl)methyl]phenyl]butanoic acid.
| Compound Name | 2,4-dioxo-4-[3-[(2,3,4,5,6-pentafluorophenyl)methyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 22613104 |
| Molecular Formula | C17H9F5O4 |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 2,4-dioxo-4-[3-[(2,3,4,5,6-pentafluorophenyl)methyl]phenyl]butanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1cccc(Cc2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C17H9F5O4/c18-12-9(13(19)15(21)16(22)14(12)20)5-7-2-1-3-8(4-7)10(23)6-11(24)17(25)26/h1-4H,5-6H2,(H,25,26) |
| InChIKey | XYCOYROBQVSBIC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|