C16H13NO4 — CID 22613036
2,4-dioxo-4-[3-(pyridin-2-ylmethyl)phenyl]butanoic acid (PubChem CID 22613036) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is 2,4-dioxo-4-[3-(pyridin-2-ylmethyl)phenyl]butanoic acid.
| Compound Name | 2,4-dioxo-4-[3-(pyridin-2-ylmethyl)phenyl]butanoic acid |
|---|---|
| PubChem CID | 22613036 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2,4-dioxo-4-[3-(pyridin-2-ylmethyl)phenyl]butanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1cccc(Cc2ccccn2)c1 |
| InChI | InChI=1S/C16H13NO4/c18-14(10-15(19)16(20)21)12-5-3-4-11(8-12)9-13-6-1-2-7-17-13/h1-8H,9-10H2,(H,20,21) |
| InChIKey | WIZBIAJDQLPLKT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|