2,4-dioxo-4-[2-(pyridin-2-ylmethyl)furan-3-yl]butanoic acid

C14H11NO5 — CID 90980033

IUPAC2,4-dioxo-4-[2-(pyridin-2-ylmethyl)furan-3-yl]butanoic acid
SMILESO=C(O)C(=O)CC(=O)c1ccoc1Cc1ccccn1
InChIInChI=1S/C14H11NO5/c16-11(8-12(17)14(18)19)10-4-6-20-13(10)7-9-3-1-2-5-15-9/h1-6H,7-8H2,(H,18,19)
InChIKeyWEJPIZJKLOQJJK-UHFFFAOYSA-N
MW273.24 g/mol
LogP1.49
Rot. Bonds6

About 2,4-dioxo-4-[2-(pyridin-2-ylmethyl)furan-3-yl]butanoic acid

2,4-dioxo-4-[2-(pyridin-2-ylmethyl)furan-3-yl]butanoic acid (PubChem CID 90980033) has the molecular formula C14H11NO5 and a molecular weight of 273.24 g/mol. Its IUPAC name is 2,4-dioxo-4-[2-(pyridin-2-ylmethyl)furan-3-yl]butanoic acid.

Molecular Properties

Compound Name2,4-dioxo-4-[2-(pyridin-2-ylmethyl)furan-3-yl]butanoic acid
PubChem CID90980033
Molecular FormulaC14H11NO5
Molecular Weight273.24 g/mol
Exact Mass273.06
IUPAC Name2,4-dioxo-4-[2-(pyridin-2-ylmethyl)furan-3-yl]butanoic acid
SMILESO=C(O)C(=O)CC(=O)c1ccoc1Cc1ccccn1
InChIInChI=1S/C14H11NO5/c16-11(8-12(17)14(18)19)10-4-6-20-13(10)7-9-3-1-2-5-15-9/h1-6H,7-8H2,(H,18,19)
InChIKeyWEJPIZJKLOQJJK-UHFFFAOYSA-N
XLogP1.49
TPSA97.47 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.24
LogP ≤ 51.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze 2,4-dioxo-4-[2-(pyridin-2-ylmethyl)furan-3-yl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,4-dioxo-4-[2-(pyridin-2-ylmethyl)furan-3-yl]butanoic acid?
The IUPAC name of 2,4-dioxo-4-[2-(pyridin-2-ylmethyl)furan-3-yl]butanoic acid (CID 90980033) is 2,4-dioxo-4-[2-(pyridin-2-ylmethyl)furan-3-yl]butanoic acid.
What is the SMILES notation for 2,4-dioxo-4-[2-(pyridin-2-ylmethyl)furan-3-yl]butanoic acid?
The canonical SMILES for 2,4-dioxo-4-[2-(pyridin-2-ylmethyl)furan-3-yl]butanoic acid is O=C(O)C(=O)CC(=O)c1ccoc1Cc1ccccn1.
What is the InChIKey of 2,4-dioxo-4-[2-(pyridin-2-ylmethyl)furan-3-yl]butanoic acid?
The InChIKey is WEJPIZJKLOQJJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO5/c16-11(8-12(17)14(18)19)10-4-6-20-13(10)7-9-3-1-2-5-15-9/h1-6H,7-8H2,(H,18,19).
What are the key properties of 2,4-dioxo-4-[2-(pyridin-2-ylmethyl)furan-3-yl]butanoic acid?
2,4-dioxo-4-[2-(pyridin-2-ylmethyl)furan-3-yl]butanoic acid has a molecular weight of 273.24 g/mol, XLogP of 1.49, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dioxo-4-[2-(pyridin-2-ylmethyl)furan-3-yl]butanoic acid is sourced from PubChem (CID 90980033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).