C14H12N2O4 — CID 91151493
2,4-dioxo-4-[5-(pyridin-2-ylmethyl)-1H-pyrrol-2-yl]butanoic acid (PubChem CID 91151493) has the molecular formula C14H12N2O4 and a molecular weight of 272.26 g/mol. Its IUPAC name is 2,4-dioxo-4-[5-(pyridin-2-ylmethyl)-1H-pyrrol-2-yl]butanoic acid.
| Compound Name | 2,4-dioxo-4-[5-(pyridin-2-ylmethyl)-1H-pyrrol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 91151493 |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2,4-dioxo-4-[5-(pyridin-2-ylmethyl)-1H-pyrrol-2-yl]butanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1ccc(Cc2ccccn2)[nH]1 |
| InChI | InChI=1S/C14H12N2O4/c17-12(8-13(18)14(19)20)11-5-4-10(16-11)7-9-3-1-2-6-15-9/h1-6,16H,7-8H2,(H,19,20) |
| InChIKey | HAOWULHTDYPQSW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 100.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|