C21H16N2O5 — CID 22613155
4-(5-benzyl-2-pyrimidin-2-yloxyphenyl)-2,4-dioxobutanoic acid (PubChem CID 22613155) has the molecular formula C21H16N2O5 and a molecular weight of 376.37 g/mol. Its IUPAC name is 4-(5-benzyl-2-pyrimidin-2-yloxyphenyl)-2,4-dioxobutanoic acid.
| Compound Name | 4-(5-benzyl-2-pyrimidin-2-yloxyphenyl)-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 22613155 |
| Molecular Formula | C21H16N2O5 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 4-(5-benzyl-2-pyrimidin-2-yloxyphenyl)-2,4-dioxobutanoic acid |
| SMILES | O=C(O)C(=O)CC(=O)c1cc(Cc2ccccc2)ccc1Oc1ncccn1 |
| InChI | InChI=1S/C21H16N2O5/c24-17(13-18(25)20(26)27)16-12-15(11-14-5-2-1-3-6-14)7-8-19(16)28-21-22-9-4-10-23-21/h1-10,12H,11,13H2,(H,26,27) |
| InChIKey | QNRRDAMSPMWQQK-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|