C19H18F3NO3 — CID 120552784
3-[2-oxo-2-[1-[2-(trifluoromethyl)phenyl]propan-2-ylamino]ethyl]benzoic acid (PubChem CID 120552784) has the molecular formula C19H18F3NO3 and a molecular weight of 365.35 g/mol. Its IUPAC name is 3-[2-oxo-2-[1-[2-(trifluoromethyl)phenyl]propan-2-ylamino]ethyl]benzoic acid.
| Compound Name | 3-[2-oxo-2-[1-[2-(trifluoromethyl)phenyl]propan-2-ylamino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 120552784 |
| Molecular Formula | C19H18F3NO3 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 3-[2-oxo-2-[1-[2-(trifluoromethyl)phenyl]propan-2-ylamino]ethyl]benzoic acid |
| SMILES | CC(Cc1ccccc1C(F)(F)F)NC(=O)Cc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C19H18F3NO3/c1-12(9-14-6-2-3-8-16(14)19(20,21)22)23-17(24)11-13-5-4-7-15(10-13)18(25)26/h2-8,10,12H,9,11H2,1H3,(H,23,24)(H,25,26) |
| InChIKey | AWYYYPRPABBOLW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |