C24H28ClF3N2O7S2 — CID 69078167
3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(3-methylsulfonylpropoxy)phenyl]-N-pentylsulfonylprop-2-enamide (PubChem CID 69078167) has the molecular formula C24H28ClF3N2O7S2 and a molecular weight of 613.08 g/mol. Its IUPAC name is 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(3-methylsulfonylpropoxy)phenyl]-N-pentylsulfonylprop-2-enamide.
| Compound Name | 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(3-methylsulfonylpropoxy)phenyl]-N-pentylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 69078167 |
| Molecular Formula | C24H28ClF3N2O7S2 |
| Molecular Weight | 613.08 g/mol |
| Exact Mass | 612.10 |
| IUPAC Name | 3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(3-methylsulfonylpropoxy)phenyl]-N-pentylsulfonylprop-2-enamide |
| SMILES | CCCCCS(=O)(=O)NC(=O)C=Cc1ccc(OCCCS(C)(=O)=O)cc1Oc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C24H28ClF3N2O7S2/c1-3-4-5-13-39(34,35)30-22(31)10-8-17-7-9-19(36-11-6-12-38(2,32)33)15-21(17)37-23-20(25)14-18(16-29-23)24(26,27)28/h7-10,14-16H,3-6,11-13H2,1-2H3,(H,30,31) |
| InChIKey | HFCNMKCFAGFADR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 128.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.08 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|