C22H27ClN2O6S — CID 70685690
(E)-3-[2-[(3-chloro-2-pyridinyl)oxy]-4-(2-methoxyethoxy)phenyl]-N-pentylsulfonylprop-2-enamide (PubChem CID 70685690) has the molecular formula C22H27ClN2O6S and a molecular weight of 482.99 g/mol. Its IUPAC name is (E)-3-[2-[(3-chloro-2-pyridinyl)oxy]-4-(2-methoxyethoxy)phenyl]-N-pentylsulfonylprop-2-enamide.
| Compound Name | (E)-3-[2-[(3-chloro-2-pyridinyl)oxy]-4-(2-methoxyethoxy)phenyl]-N-pentylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 70685690 |
| Molecular Formula | C22H27ClN2O6S |
| Molecular Weight | 482.99 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | (E)-3-[2-[(3-chloro-2-pyridinyl)oxy]-4-(2-methoxyethoxy)phenyl]-N-pentylsulfonylprop-2-enamide |
| SMILES | CCCCCS(=O)(=O)NC(=O)/C=C/c1ccc(OCCOC)cc1Oc1ncccc1Cl |
| InChI | InChI=1S/C22H27ClN2O6S/c1-3-4-5-15-32(27,28)25-21(26)11-9-17-8-10-18(30-14-13-29-2)16-20(17)31-22-19(23)7-6-12-24-22/h6-12,16H,3-5,13-15H2,1-2H3,(H,25,26)/b11-9+ |
| InChIKey | PBLUAYDREMPFRL-PKNBQFBNSA-N |
| XLogP | 4.20 |
| TPSA | 103.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.99 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|