C21H27BrN2O5S2 — CID 68548190
3-[2-[(5-bromo-1,3-thiazol-2-yl)methyl]-4-(2-methoxyethoxy)phenyl]-N-pentylsulfonylprop-2-enamide (PubChem CID 68548190) has the molecular formula C21H27BrN2O5S2 and a molecular weight of 531.49 g/mol. Its IUPAC name is 3-[2-[(5-bromo-1,3-thiazol-2-yl)methyl]-4-(2-methoxyethoxy)phenyl]-N-pentylsulfonylprop-2-enamide.
| Compound Name | 3-[2-[(5-bromo-1,3-thiazol-2-yl)methyl]-4-(2-methoxyethoxy)phenyl]-N-pentylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 68548190 |
| Molecular Formula | C21H27BrN2O5S2 |
| Molecular Weight | 531.49 g/mol |
| Exact Mass | 530.05 |
| IUPAC Name | 3-[2-[(5-bromo-1,3-thiazol-2-yl)methyl]-4-(2-methoxyethoxy)phenyl]-N-pentylsulfonylprop-2-enamide |
| SMILES | CCCCCS(=O)(=O)NC(=O)C=Cc1ccc(OCCOC)cc1Cc1ncc(Br)s1 |
| InChI | InChI=1S/C21H27BrN2O5S2/c1-3-4-5-12-31(26,27)24-20(25)9-7-16-6-8-18(29-11-10-28-2)13-17(16)14-21-23-15-19(22)30-21/h6-9,13,15H,3-5,10-12,14H2,1-2H3,(H,24,25) |
| InChIKey | PVVBIPBCYPLJPR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|