About (4-octoxyphenyl) 3-(5-bromothiophen-2-yl)prop-2-enoate
(4-octoxyphenyl) 3-(5-bromothiophen-2-yl)prop-2-enoate (PubChem CID 71329520) has the molecular formula C21H25BrO3S
and a molecular weight of 437.40 g/mol. Its IUPAC name is (4-octoxyphenyl) 3-(5-bromothiophen-2-yl)prop-2-enoate.
Molecular Properties
| Compound Name | (4-octoxyphenyl) 3-(5-bromothiophen-2-yl)prop-2-enoate |
| PubChem CID | 71329520 |
| Molecular Formula | C21H25BrO3S |
| Molecular Weight | 437.40 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | (4-octoxyphenyl) 3-(5-bromothiophen-2-yl)prop-2-enoate |
| SMILES | CCCCCCCCOc1ccc(OC(=O)C=Cc2ccc(Br)s2)cc1 |
| InChI | InChI=1S/C21H25BrO3S/c1-2-3-4-5-6-7-16-24-17-8-10-18(11-9-17)25-21(23)15-13-19-12-14-20(22)26-19/h8-15H,2-7,16H2,1H3 |
| InChIKey | AVRXMQPJWHCGAJ-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.40 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-octoxyphenyl) 3-(5-bromothiophen-2-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-octoxyphenyl) 3-(5-bromothiophen-2-yl)prop-2-enoate?
The IUPAC name of (4-octoxyphenyl) 3-(5-bromothiophen-2-yl)prop-2-enoate (CID 71329520) is (4-octoxyphenyl) 3-(5-bromothiophen-2-yl)prop-2-enoate.
What is the SMILES notation for (4-octoxyphenyl) 3-(5-bromothiophen-2-yl)prop-2-enoate?
The canonical SMILES for (4-octoxyphenyl) 3-(5-bromothiophen-2-yl)prop-2-enoate is CCCCCCCCOc1ccc(OC(=O)C=Cc2ccc(Br)s2)cc1.
What is the InChIKey of (4-octoxyphenyl) 3-(5-bromothiophen-2-yl)prop-2-enoate?
The InChIKey is AVRXMQPJWHCGAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25BrO3S/c1-2-3-4-5-6-7-16-24-17-8-10-18(11-9-17)25-21(23)15-13-19-12-14-20(22)26-19/h8-15H,2-7,16H2,1H3.
What are the key properties of (4-octoxyphenyl) 3-(5-bromothiophen-2-yl)prop-2-enoate?
(4-octoxyphenyl) 3-(5-bromothiophen-2-yl)prop-2-enoate has a molecular weight of 437.40 g/mol, XLogP of 6.87, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-octoxyphenyl) 3-(5-bromothiophen-2-yl)prop-2-enoate is sourced from PubChem (CID 71329520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).