C19H23BrN2O3S — CID 3948561
N-[(5-bromothiophen-2-yl)methylideneamino]-2-(4-pentoxyphenoxy)propanamide (PubChem CID 3948561) has the molecular formula C19H23BrN2O3S and a molecular weight of 439.38 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methylideneamino]-2-(4-pentoxyphenoxy)propanamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methylideneamino]-2-(4-pentoxyphenoxy)propanamide |
|---|---|
| PubChem CID | 3948561 |
| Molecular Formula | C19H23BrN2O3S |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methylideneamino]-2-(4-pentoxyphenoxy)propanamide |
| SMILES | CCCCCOc1ccc(OC(C)C(=O)NN=Cc2ccc(Br)s2)cc1 |
| InChI | InChI=1S/C19H23BrN2O3S/c1-3-4-5-12-24-15-6-8-16(9-7-15)25-14(2)19(23)22-21-13-17-10-11-18(20)26-17/h6-11,13-14H,3-5,12H2,1-2H3,(H,22,23) |
| InChIKey | YJQKFYQHISYWNO-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|