C15H15ClN2O2S — CID 1229715
(2S)-2-(4-chlorophenoxy)-N-[(5-methylthiophen-2-yl)methylideneamino]propanamide (PubChem CID 1229715) has the molecular formula C15H15ClN2O2S and a molecular weight of 322.82 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenoxy)-N-[(5-methylthiophen-2-yl)methylideneamino]propanamide.
| Compound Name | (2S)-2-(4-chlorophenoxy)-N-[(5-methylthiophen-2-yl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 1229715 |
| Molecular Formula | C15H15ClN2O2S |
| Molecular Weight | 322.82 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | (2S)-2-(4-chlorophenoxy)-N-[(5-methylthiophen-2-yl)methylideneamino]propanamide |
| SMILES | Cc1ccc(C=NNC(=O)[C@H](C)Oc2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C15H15ClN2O2S/c1-10-3-8-14(21-10)9-17-18-15(19)11(2)20-13-6-4-12(16)5-7-13/h3-9,11H,1-2H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | UOOWJIFFARTSAC-NSHDSACASA-N |
| XLogP | 3.63 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.82 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|