C17H15Cl2NO5 — CID 68548203
(E)-3-[2-[(3,5-dichloro-2-pyridinyl)oxy]-4-(2-methoxyethoxy)phenyl]prop-2-enoic acid (PubChem CID 68548203) has the molecular formula C17H15Cl2NO5 and a molecular weight of 384.22 g/mol. Its IUPAC name is (E)-3-[2-[(3,5-dichloro-2-pyridinyl)oxy]-4-(2-methoxyethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[(3,5-dichloro-2-pyridinyl)oxy]-4-(2-methoxyethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68548203 |
| Molecular Formula | C17H15Cl2NO5 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | (E)-3-[2-[(3,5-dichloro-2-pyridinyl)oxy]-4-(2-methoxyethoxy)phenyl]prop-2-enoic acid |
| SMILES | COCCOc1ccc(/C=C/C(=O)O)c(Oc2ncc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H15Cl2NO5/c1-23-6-7-24-13-4-2-11(3-5-16(21)22)15(9-13)25-17-14(19)8-12(18)10-20-17/h2-5,8-10H,6-7H2,1H3,(H,21,22)/b5-3+ |
| InChIKey | LGRXXWPUWRXFGQ-HWKANZROSA-N |
| XLogP | 4.30 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|