C19H16F3NO7 — CID 68549748
3-[4-(2-methoxyethoxy)-2-[2-nitro-5-(trifluoromethyl)phenoxy]phenyl]prop-2-enoic acid (PubChem CID 68549748) has the molecular formula C19H16F3NO7 and a molecular weight of 427.33 g/mol. Its IUPAC name is 3-[4-(2-methoxyethoxy)-2-[2-nitro-5-(trifluoromethyl)phenoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-(2-methoxyethoxy)-2-[2-nitro-5-(trifluoromethyl)phenoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68549748 |
| Molecular Formula | C19H16F3NO7 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 3-[4-(2-methoxyethoxy)-2-[2-nitro-5-(trifluoromethyl)phenoxy]phenyl]prop-2-enoic acid |
| SMILES | COCCOc1ccc(C=CC(=O)O)c(Oc2cc(C(F)(F)F)ccc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H16F3NO7/c1-28-8-9-29-14-5-2-12(3-7-18(24)25)16(11-14)30-17-10-13(19(20,21)22)4-6-15(17)23(26)27/h2-7,10-11H,8-9H2,1H3,(H,24,25) |
| InChIKey | QPMSOGDMNRXNLW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|