C24H26O9 — CID 89026724
(Z)-3-[4-[2-[2-[4-[(E)-2-carboxyethenyl]-3-methoxyphenoxy]ethoxy]ethoxy]-2-methoxyphenyl]prop-2-enoic acid (PubChem CID 89026724) has the molecular formula C24H26O9 and a molecular weight of 458.46 g/mol. Its IUPAC name is (Z)-3-[4-[2-[2-[4-[(E)-2-carboxyethenyl]-3-methoxyphenoxy]ethoxy]ethoxy]-2-methoxyphenyl]prop-2-enoic acid.
| Compound Name | (Z)-3-[4-[2-[2-[4-[(E)-2-carboxyethenyl]-3-methoxyphenoxy]ethoxy]ethoxy]-2-methoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 89026724 |
| Molecular Formula | C24H26O9 |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | (Z)-3-[4-[2-[2-[4-[(E)-2-carboxyethenyl]-3-methoxyphenoxy]ethoxy]ethoxy]-2-methoxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc(OCCOCCOc2ccc(/C=C/C(=O)O)c(OC)c2)ccc1/C=C\C(=O)O |
| InChI | InChI=1S/C24H26O9/c1-29-21-15-19(7-3-17(21)5-9-23(25)26)32-13-11-31-12-14-33-20-8-4-18(6-10-24(27)28)22(16-20)30-2/h3-10,15-16H,11-14H2,1-2H3,(H,25,26)(H,27,28)/b9-5-,10-6+ |
| InChIKey | YVORCSHEGXYQHZ-VTBWALSUSA-N |
| XLogP | 3.37 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|