C21H24F3N5O3S — CID 66860294
3-[1,3-dimethyl-5-[5-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]pyrazol-4-yl]-N-pentylsulfonylprop-2-enamide (PubChem CID 66860294) has the molecular formula C21H24F3N5O3S and a molecular weight of 483.52 g/mol. Its IUPAC name is 3-[1,3-dimethyl-5-[5-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]pyrazol-4-yl]-N-pentylsulfonylprop-2-enamide.
| Compound Name | 3-[1,3-dimethyl-5-[5-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]pyrazol-4-yl]-N-pentylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 66860294 |
| Molecular Formula | C21H24F3N5O3S |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 3-[1,3-dimethyl-5-[5-(trifluoromethyl)pyrrolo[2,3-b]pyridin-1-yl]pyrazol-4-yl]-N-pentylsulfonylprop-2-enamide |
| SMILES | CCCCCS(=O)(=O)NC(=O)C=Cc1c(C)nn(C)c1-n1ccc2cc(C(F)(F)F)cnc21 |
| InChI | InChI=1S/C21H24F3N5O3S/c1-4-5-6-11-33(31,32)27-18(30)8-7-17-14(2)26-28(3)20(17)29-10-9-15-12-16(21(22,23)24)13-25-19(15)29/h7-10,12-13H,4-6,11H2,1-3H3,(H,27,30) |
| InChIKey | VQIPMTCLLAGUPL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 98.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|