C22H25F3N6O3S — CID 174588840
(E)-N-[3-(butylamino)prop-2-enylsulfonyl]-3-[1-methyl-5-pyrrolo[2,3-b]pyridin-1-yl-3-(trifluoromethyl)pyrazol-4-yl]prop-2-enamide (PubChem CID 174588840) has the molecular formula C22H25F3N6O3S and a molecular weight of 510.54 g/mol. Its IUPAC name is (E)-N-[3-(butylamino)prop-2-enylsulfonyl]-3-[1-methyl-5-pyrrolo[2,3-b]pyridin-1-yl-3-(trifluoromethyl)pyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-[3-(butylamino)prop-2-enylsulfonyl]-3-[1-methyl-5-pyrrolo[2,3-b]pyridin-1-yl-3-(trifluoromethyl)pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 174588840 |
| Molecular Formula | C22H25F3N6O3S |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.17 |
| IUPAC Name | (E)-N-[3-(butylamino)prop-2-enylsulfonyl]-3-[1-methyl-5-pyrrolo[2,3-b]pyridin-1-yl-3-(trifluoromethyl)pyrazol-4-yl]prop-2-enamide |
| SMILES | CCCCNC=CCS(=O)(=O)NC(=O)/C=C/c1c(C(F)(F)F)nn(C)c1-n1ccc2cccnc21 |
| InChI | InChI=1S/C22H25F3N6O3S/c1-3-4-11-26-12-6-15-35(33,34)29-18(32)9-8-17-19(22(23,24)25)28-30(2)21(17)31-14-10-16-7-5-13-27-20(16)31/h5-10,12-14,26H,3-4,11,15H2,1-2H3,(H,29,32)/b9-8+,12-6? |
| InChIKey | AAWPTGZEEJRFPY-XHZBUCITSA-N |
| XLogP | 3.14 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|