C22H28N6O3S — CID 69316032
(E)-N-(cyclohexylmethylsulfamoyl)-3-(1,3-dimethyl-5-pyrrolo[2,3-b]pyridin-1-ylpyrazol-4-yl)prop-2-enamide (PubChem CID 69316032) has the molecular formula C22H28N6O3S and a molecular weight of 456.57 g/mol. Its IUPAC name is (E)-N-(cyclohexylmethylsulfamoyl)-3-(1,3-dimethyl-5-pyrrolo[2,3-b]pyridin-1-ylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-(cyclohexylmethylsulfamoyl)-3-(1,3-dimethyl-5-pyrrolo[2,3-b]pyridin-1-ylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 69316032 |
| Molecular Formula | C22H28N6O3S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | (E)-N-(cyclohexylmethylsulfamoyl)-3-(1,3-dimethyl-5-pyrrolo[2,3-b]pyridin-1-ylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cc1nn(C)c(-n2ccc3cccnc32)c1/C=C/C(=O)NS(=O)(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C22H28N6O3S/c1-16-19(22(27(2)25-16)28-14-12-18-9-6-13-23-21(18)28)10-11-20(29)26-32(30,31)24-15-17-7-4-3-5-8-17/h6,9-14,17,24H,3-5,7-8,15H2,1-2H3,(H,26,29)/b11-10+ |
| InChIKey | IDQFHTJIXSYGMJ-ZHACJKMWSA-N |
| XLogP | 2.61 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|