C20H26N6O3S — CID 66859391
(E)-N-(butylsulfamoyl)-3-[1,3-dimethyl-5-(3-methylpyrrolo[2,3-b]pyridin-1-yl)pyrazol-4-yl]prop-2-enamide (PubChem CID 66859391) has the molecular formula C20H26N6O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is (E)-N-(butylsulfamoyl)-3-[1,3-dimethyl-5-(3-methylpyrrolo[2,3-b]pyridin-1-yl)pyrazol-4-yl]prop-2-enamide.
| Compound Name | (E)-N-(butylsulfamoyl)-3-[1,3-dimethyl-5-(3-methylpyrrolo[2,3-b]pyridin-1-yl)pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 66859391 |
| Molecular Formula | C20H26N6O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (E)-N-(butylsulfamoyl)-3-[1,3-dimethyl-5-(3-methylpyrrolo[2,3-b]pyridin-1-yl)pyrazol-4-yl]prop-2-enamide |
| SMILES | CCCCNS(=O)(=O)NC(=O)/C=C/c1c(C)nn(C)c1-n1cc(C)c2cccnc21 |
| InChI | InChI=1S/C20H26N6O3S/c1-5-6-12-22-30(28,29)24-18(27)10-9-17-15(3)23-25(4)20(17)26-13-14(2)16-8-7-11-21-19(16)26/h7-11,13,22H,5-6,12H2,1-4H3,(H,24,27)/b10-9+ |
| InChIKey | POBGPSUIYNIKPK-MDZDMXLPSA-N |
| XLogP | 2.14 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|