C21H27N5O3S — CID 66860077
N-(butylsulfamoyl)-3-[1,3-dimethyl-5-(1-methylindol-3-yl)pyrazol-4-yl]prop-2-enamide (PubChem CID 66860077) has the molecular formula C21H27N5O3S and a molecular weight of 429.55 g/mol. Its IUPAC name is N-(butylsulfamoyl)-3-[1,3-dimethyl-5-(1-methylindol-3-yl)pyrazol-4-yl]prop-2-enamide.
| Compound Name | N-(butylsulfamoyl)-3-[1,3-dimethyl-5-(1-methylindol-3-yl)pyrazol-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 66860077 |
| Molecular Formula | C21H27N5O3S |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | N-(butylsulfamoyl)-3-[1,3-dimethyl-5-(1-methylindol-3-yl)pyrazol-4-yl]prop-2-enamide |
| SMILES | CCCCNS(=O)(=O)NC(=O)C=Cc1c(C)nn(C)c1-c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C21H27N5O3S/c1-5-6-13-22-30(28,29)24-20(27)12-11-16-15(2)23-26(4)21(16)18-14-25(3)19-10-8-7-9-17(18)19/h7-12,14,22H,5-6,13H2,1-4H3,(H,24,27) |
| InChIKey | VRAAZXNABWSAHB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|