C19H21N3O2 — CID 66859139
2-[[1,3-dimethyl-5-(1-methylindol-3-yl)pyrazol-4-yl]methylidene]butanoic acid (PubChem CID 66859139) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 2-[[1,3-dimethyl-5-(1-methylindol-3-yl)pyrazol-4-yl]methylidene]butanoic acid.
| Compound Name | 2-[[1,3-dimethyl-5-(1-methylindol-3-yl)pyrazol-4-yl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 66859139 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-[[1,3-dimethyl-5-(1-methylindol-3-yl)pyrazol-4-yl]methylidene]butanoic acid |
| SMILES | CCC(=Cc1c(C)nn(C)c1-c1cn(C)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C19H21N3O2/c1-5-13(19(23)24)10-15-12(2)20-22(4)18(15)16-11-21(3)17-9-7-6-8-14(16)17/h6-11H,5H2,1-4H3,(H,23,24) |
| InChIKey | PXCGLLGDPVFPRB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|