C19H18N4O2 — CID 66860302
(2E)-2-[[5-(5-cyanoindol-1-yl)-1,3-dimethylpyrazol-4-yl]methylidene]butanoic acid (PubChem CID 66860302) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is (2E)-2-[[5-(5-cyanoindol-1-yl)-1,3-dimethylpyrazol-4-yl]methylidene]butanoic acid.
| Compound Name | (2E)-2-[[5-(5-cyanoindol-1-yl)-1,3-dimethylpyrazol-4-yl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 66860302 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (2E)-2-[[5-(5-cyanoindol-1-yl)-1,3-dimethylpyrazol-4-yl]methylidene]butanoic acid |
| SMILES | CC/C(=C\c1c(C)nn(C)c1-n1ccc2cc(C#N)ccc21)C(=O)O |
| InChI | InChI=1S/C19H18N4O2/c1-4-14(19(24)25)10-16-12(2)21-22(3)18(16)23-8-7-15-9-13(11-20)5-6-17(15)23/h5-10H,4H2,1-3H3,(H,24,25)/b14-10+ |
| InChIKey | JCYWTPVNMNLAMM-GXDHUFHOSA-N |
| XLogP | 3.42 |
| TPSA | 83.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|