C16H14FN3O2 — CID 66859604
(E)-3-[5-(6-fluoroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid (PubChem CID 66859604) has the molecular formula C16H14FN3O2 and a molecular weight of 299.31 g/mol. Its IUPAC name is (E)-3-[5-(6-fluoroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-(6-fluoroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66859604 |
| Molecular Formula | C16H14FN3O2 |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (E)-3-[5-(6-fluoroindol-1-yl)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid |
| SMILES | Cc1nn(C)c(-n2ccc3ccc(F)cc32)c1/C=C/C(=O)O |
| InChI | InChI=1S/C16H14FN3O2/c1-10-13(5-6-15(21)22)16(19(2)18-10)20-8-7-11-3-4-12(17)9-14(11)20/h3-9H,1-2H3,(H,21,22)/b6-5+ |
| InChIKey | PWAOGXBHUAYJQV-AATRIKPKSA-N |
| XLogP | 2.91 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|