C24H30N6O3S — CID 174603879
(E)-N-[3-(butylamino)prop-2-enylsulfonyl]-3-(3-cyclopropyl-1-methyl-5-pyrrolo[2,3-b]pyridin-1-ylpyrazol-4-yl)prop-2-enamide (PubChem CID 174603879) has the molecular formula C24H30N6O3S and a molecular weight of 482.61 g/mol. Its IUPAC name is (E)-N-[3-(butylamino)prop-2-enylsulfonyl]-3-(3-cyclopropyl-1-methyl-5-pyrrolo[2,3-b]pyridin-1-ylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[3-(butylamino)prop-2-enylsulfonyl]-3-(3-cyclopropyl-1-methyl-5-pyrrolo[2,3-b]pyridin-1-ylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 174603879 |
| Molecular Formula | C24H30N6O3S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | (E)-N-[3-(butylamino)prop-2-enylsulfonyl]-3-(3-cyclopropyl-1-methyl-5-pyrrolo[2,3-b]pyridin-1-ylpyrazol-4-yl)prop-2-enamide |
| SMILES | CCCCNC=CCS(=O)(=O)NC(=O)/C=C/c1c(C2CC2)nn(C)c1-n1ccc2cccnc21 |
| InChI | InChI=1S/C24H30N6O3S/c1-3-4-13-25-14-6-17-34(32,33)28-21(31)11-10-20-22(18-8-9-18)27-29(2)24(20)30-16-12-19-7-5-15-26-23(19)30/h5-7,10-12,14-16,18,25H,3-4,8-9,13,17H2,1-2H3,(H,28,31)/b11-10+,14-6? |
| InChIKey | VHQWWALMDXJAPM-IISXWRHVSA-N |
| XLogP | 3.00 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|