C22H25N5O3S — CID 66860461
3-[5-(5-cyanoindol-1-yl)-1,3-dimethylpyrazol-4-yl]-N-pentylsulfonylprop-2-enamide (PubChem CID 66860461) has the molecular formula C22H25N5O3S and a molecular weight of 439.54 g/mol. Its IUPAC name is 3-[5-(5-cyanoindol-1-yl)-1,3-dimethylpyrazol-4-yl]-N-pentylsulfonylprop-2-enamide.
| Compound Name | 3-[5-(5-cyanoindol-1-yl)-1,3-dimethylpyrazol-4-yl]-N-pentylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 66860461 |
| Molecular Formula | C22H25N5O3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 3-[5-(5-cyanoindol-1-yl)-1,3-dimethylpyrazol-4-yl]-N-pentylsulfonylprop-2-enamide |
| SMILES | CCCCCS(=O)(=O)NC(=O)C=Cc1c(C)nn(C)c1-n1ccc2cc(C#N)ccc21 |
| InChI | InChI=1S/C22H25N5O3S/c1-4-5-6-13-31(29,30)25-21(28)10-8-19-16(2)24-26(3)22(19)27-12-11-18-14-17(15-23)7-9-20(18)27/h7-12,14H,4-6,13H2,1-3H3,(H,25,28) |
| InChIKey | CSEZHTCBRLPMEZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|