C18H21Cl2N3O3S — CID 18315556
4-amino-N-butylsulfonyl-3-[(2,4-dichlorophenyl)methylamino]benzamide (PubChem CID 18315556) has the molecular formula C18H21Cl2N3O3S and a molecular weight of 430.36 g/mol. Its IUPAC name is 4-amino-N-butylsulfonyl-3-[(2,4-dichlorophenyl)methylamino]benzamide.
| Compound Name | 4-amino-N-butylsulfonyl-3-[(2,4-dichlorophenyl)methylamino]benzamide |
|---|---|
| PubChem CID | 18315556 |
| Molecular Formula | C18H21Cl2N3O3S |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | 4-amino-N-butylsulfonyl-3-[(2,4-dichlorophenyl)methylamino]benzamide |
| SMILES | CCCCS(=O)(=O)NC(=O)c1ccc(N)c(NCc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H21Cl2N3O3S/c1-2-3-8-27(25,26)23-18(24)12-5-7-16(21)17(9-12)22-11-13-4-6-14(19)10-15(13)20/h4-7,9-10,22H,2-3,8,11,21H2,1H3,(H,23,24) |
| InChIKey | KXJATGIDKANRDG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|