C20H19ClF3NO5 — CID 131738687
ethyl (E)-3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(methoxymethoxy)phenyl]-2-methylprop-2-enoate (PubChem CID 131738687) has the molecular formula C20H19ClF3NO5 and a molecular weight of 445.82 g/mol. Its IUPAC name is ethyl (E)-3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(methoxymethoxy)phenyl]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(methoxymethoxy)phenyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 131738687 |
| Molecular Formula | C20H19ClF3NO5 |
| Molecular Weight | 445.82 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | ethyl (E)-3-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]oxy]-4-(methoxymethoxy)phenyl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/c1ccc(OCOC)cc1Oc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C20H19ClF3NO5/c1-4-28-19(26)12(2)7-13-5-6-15(29-11-27-3)9-17(13)30-18-16(21)8-14(10-25-18)20(22,23)24/h5-10H,4,11H2,1-3H3/b12-7+ |
| InChIKey | OWIKJTZRDFJYEE-KPKJPENVSA-N |
| XLogP | 5.50 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.82 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|