About 4-(dichloromethyl)piperidine;4-ethoxybenzoic acid
4-(dichloromethyl)piperidine;4-ethoxybenzoic acid (PubChem CID 175416448) has the molecular formula C15H21Cl2NO3
and a molecular weight of 334.24 g/mol. Its IUPAC name is 4-(dichloromethyl)piperidine;4-ethoxybenzoic acid.
Molecular Properties
| Compound Name | 4-(dichloromethyl)piperidine;4-ethoxybenzoic acid |
| PubChem CID | 175416448 |
| Molecular Formula | C15H21Cl2NO3 |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 4-(dichloromethyl)piperidine;4-ethoxybenzoic acid |
| SMILES | CCOc1ccc(C(=O)O)cc1.ClC(Cl)C1CCNCC1 |
| InChI | InChI=1S/C9H10O3.C6H11Cl2N/c1-2-12-8-5-3-7(4-6-8)9(10)11;7-6(8)5-1-3-9-4-2-5/h3-6H,2H2,1H3,(H,10,11);5-6,9H,1-4H2 |
| InChIKey | DALOXXNSRZIBDD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(dichloromethyl)piperidine;4-ethoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dichloromethyl)piperidine;4-ethoxybenzoic acid?
The IUPAC name of 4-(dichloromethyl)piperidine;4-ethoxybenzoic acid (CID 175416448) is 4-(dichloromethyl)piperidine;4-ethoxybenzoic acid.
What is the SMILES notation for 4-(dichloromethyl)piperidine;4-ethoxybenzoic acid?
The canonical SMILES for 4-(dichloromethyl)piperidine;4-ethoxybenzoic acid is CCOc1ccc(C(=O)O)cc1.ClC(Cl)C1CCNCC1.
What is the InChIKey of 4-(dichloromethyl)piperidine;4-ethoxybenzoic acid?
The InChIKey is DALOXXNSRZIBDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O3.C6H11Cl2N/c1-2-12-8-5-3-7(4-6-8)9(10)11;7-6(8)5-1-3-9-4-2-5/h3-6H,2H2,1H3,(H,10,11);5-6,9H,1-4H2.
What are the key properties of 4-(dichloromethyl)piperidine;4-ethoxybenzoic acid?
4-(dichloromethyl)piperidine;4-ethoxybenzoic acid has a molecular weight of 334.24 g/mol, XLogP of 3.57, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dichloromethyl)piperidine;4-ethoxybenzoic acid is sourced from PubChem (CID 175416448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).