C15H16ClN3 — CID 156719458
7-chloro-2-(1-piperidin-4-ylethenyl)-1,6-naphthyridine (PubChem CID 156719458) has the molecular formula C15H16ClN3 and a molecular weight of 273.77 g/mol. Its IUPAC name is 7-chloro-2-(1-piperidin-4-ylethenyl)-1,6-naphthyridine.
| Compound Name | 7-chloro-2-(1-piperidin-4-ylethenyl)-1,6-naphthyridine |
|---|---|
| PubChem CID | 156719458 |
| Molecular Formula | C15H16ClN3 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 7-chloro-2-(1-piperidin-4-ylethenyl)-1,6-naphthyridine |
| SMILES | C=C(c1ccc2cnc(Cl)cc2n1)C1CCNCC1 |
| InChI | InChI=1S/C15H16ClN3/c1-10(11-4-6-17-7-5-11)13-3-2-12-9-18-15(16)8-14(12)19-13/h2-3,8-9,11,17H,1,4-7H2 |
| InChIKey | DNFHQULRJHZGOO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|