C17H19ClN2O2 — CID 162439706
7-chloro-2-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)-1,6-naphthyridine (PubChem CID 162439706) has the molecular formula C17H19ClN2O2 and a molecular weight of 318.80 g/mol. Its IUPAC name is 7-chloro-2-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)-1,6-naphthyridine.
| Compound Name | 7-chloro-2-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)-1,6-naphthyridine |
|---|---|
| PubChem CID | 162439706 |
| Molecular Formula | C17H19ClN2O2 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 7-chloro-2-(1,4-dioxaspiro[4.5]decan-8-ylmethyl)-1,6-naphthyridine |
| SMILES | Clc1cc2nc(CC3CCC4(CC3)OCCO4)ccc2cn1 |
| InChI | InChI=1S/C17H19ClN2O2/c18-16-10-15-13(11-19-16)1-2-14(20-15)9-12-3-5-17(6-4-12)21-7-8-22-17/h1-2,10-12H,3-9H2 |
| InChIKey | JHGVIDRYGYZLRH-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|