C25H27FN6 — CID 156719511
4-N-ethenyl-2-fluoro-4-N-(methylideneamino)-1-N-[2-[1-(1-methylpiperidin-4-yl)ethenyl]-1,6-naphthyridin-7-yl]benzene-1,4-diamine (PubChem CID 156719511) has the molecular formula C25H27FN6 and a molecular weight of 430.53 g/mol. Its IUPAC name is 4-N-ethenyl-2-fluoro-4-N-(methylideneamino)-1-N-[2-[1-(1-methylpiperidin-4-yl)ethenyl]-1,6-naphthyridin-7-yl]benzene-1,4-diamine.
| Compound Name | 4-N-ethenyl-2-fluoro-4-N-(methylideneamino)-1-N-[2-[1-(1-methylpiperidin-4-yl)ethenyl]-1,6-naphthyridin-7-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 156719511 |
| Molecular Formula | C25H27FN6 |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.23 |
| IUPAC Name | 4-N-ethenyl-2-fluoro-4-N-(methylideneamino)-1-N-[2-[1-(1-methylpiperidin-4-yl)ethenyl]-1,6-naphthyridin-7-yl]benzene-1,4-diamine |
| SMILES | C=CN(N=C)c1ccc(Nc2cc3nc(C(=C)C4CCN(C)CC4)ccc3cn2)c(F)c1 |
| InChI | InChI=1S/C25H27FN6/c1-5-32(27-3)20-7-9-23(21(26)14-20)30-25-15-24-19(16-28-25)6-8-22(29-24)17(2)18-10-12-31(4)13-11-18/h5-9,14-16,18H,1-3,10-13H2,4H3,(H,28,30) |
| InChIKey | AMXMOVUHIAGGHR-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|