C25H25FN6O — CID 162439736
2-(2,6-dimethyl-1-oxa-6-azaspiro[2.5]octan-2-yl)-N-(2-fluoro-4-pyrazol-1-ylphenyl)-1,6-naphthyridin-7-amine (PubChem CID 162439736) has the molecular formula C25H25FN6O and a molecular weight of 444.51 g/mol. Its IUPAC name is 2-(2,6-dimethyl-1-oxa-6-azaspiro[2.5]octan-2-yl)-N-(2-fluoro-4-pyrazol-1-ylphenyl)-1,6-naphthyridin-7-amine.
| Compound Name | 2-(2,6-dimethyl-1-oxa-6-azaspiro[2.5]octan-2-yl)-N-(2-fluoro-4-pyrazol-1-ylphenyl)-1,6-naphthyridin-7-amine |
|---|---|
| PubChem CID | 162439736 |
| Molecular Formula | C25H25FN6O |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 2-(2,6-dimethyl-1-oxa-6-azaspiro[2.5]octan-2-yl)-N-(2-fluoro-4-pyrazol-1-ylphenyl)-1,6-naphthyridin-7-amine |
| SMILES | CN1CCC2(CC1)OC2(C)c1ccc2cnc(Nc3ccc(-n4cccn4)cc3F)cc2n1 |
| InChI | InChI=1S/C25H25FN6O/c1-24(25(33-24)8-12-31(2)13-9-25)22-7-4-17-16-27-23(15-21(17)29-22)30-20-6-5-18(14-19(20)26)32-11-3-10-28-32/h3-7,10-11,14-16H,8-9,12-13H2,1-2H3,(H,27,30) |
| InChIKey | XXBPTYWLFWYJGX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|