C22H20Cl3N3O — CID 56672409
3-chloro-N-[(3,4-dichlorophenyl)-piperidin-4-ylmethyl]isoquinoline-6-carboxamide (PubChem CID 56672409) has the molecular formula C22H20Cl3N3O and a molecular weight of 448.78 g/mol. Its IUPAC name is 3-chloro-N-[(3,4-dichlorophenyl)-piperidin-4-ylmethyl]isoquinoline-6-carboxamide.
| Compound Name | 3-chloro-N-[(3,4-dichlorophenyl)-piperidin-4-ylmethyl]isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 56672409 |
| Molecular Formula | C22H20Cl3N3O |
| Molecular Weight | 448.78 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | 3-chloro-N-[(3,4-dichlorophenyl)-piperidin-4-ylmethyl]isoquinoline-6-carboxamide |
| SMILES | O=C(NC(c1ccc(Cl)c(Cl)c1)C1CCNCC1)c1ccc2cnc(Cl)cc2c1 |
| InChI | InChI=1S/C22H20Cl3N3O/c23-18-4-3-14(10-19(18)24)21(13-5-7-26-8-6-13)28-22(29)15-1-2-16-12-27-20(25)11-17(16)9-15/h1-4,9-13,21,26H,5-8H2,(H,28,29) |
| InChIKey | UVUBWDHJWHNJKU-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.78 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|