3-bromo-7-chloro-1,6-naphthyridine-2-carboxylic acid

C9H4BrClN2O2 — CID 171555659

IUPAC3-bromo-7-chloro-1,6-naphthyridine-2-carboxylic acid
SMILESO=C(O)c1nc2cc(Cl)ncc2cc1Br
InChIInChI=1S/C9H4BrClN2O2/c10-5-1-4-3-12-7(11)2-6(4)13-8(5)9(14)15/h1-3H,(H,14,15)
InChIKeyFDJFKNYGTXJVCW-UHFFFAOYSA-N
MW287.50 g/mol
LogP2.74
Rot. Bonds1

About 3-bromo-7-chloro-1,6-naphthyridine-2-carboxylic acid

3-bromo-7-chloro-1,6-naphthyridine-2-carboxylic acid (PubChem CID 171555659) has the molecular formula C9H4BrClN2O2 and a molecular weight of 287.50 g/mol. Its IUPAC name is 3-bromo-7-chloro-1,6-naphthyridine-2-carboxylic acid.

Molecular Properties

Compound Name3-bromo-7-chloro-1,6-naphthyridine-2-carboxylic acid
PubChem CID171555659
Molecular FormulaC9H4BrClN2O2
Molecular Weight287.50 g/mol
Exact Mass285.91
IUPAC Name3-bromo-7-chloro-1,6-naphthyridine-2-carboxylic acid
SMILESO=C(O)c1nc2cc(Cl)ncc2cc1Br
InChIInChI=1S/C9H4BrClN2O2/c10-5-1-4-3-12-7(11)2-6(4)13-8(5)9(14)15/h1-3H,(H,14,15)
InChIKeyFDJFKNYGTXJVCW-UHFFFAOYSA-N
XLogP2.74
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.50
LogP ≤ 52.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze 3-bromo-7-chloro-1,6-naphthyridine-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-bromo-7-chloro-1,6-naphthyridine-2-carboxylic acid?
The IUPAC name of 3-bromo-7-chloro-1,6-naphthyridine-2-carboxylic acid (CID 171555659) is 3-bromo-7-chloro-1,6-naphthyridine-2-carboxylic acid.
What is the SMILES notation for 3-bromo-7-chloro-1,6-naphthyridine-2-carboxylic acid?
The canonical SMILES for 3-bromo-7-chloro-1,6-naphthyridine-2-carboxylic acid is O=C(O)c1nc2cc(Cl)ncc2cc1Br.
What is the InChIKey of 3-bromo-7-chloro-1,6-naphthyridine-2-carboxylic acid?
The InChIKey is FDJFKNYGTXJVCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4BrClN2O2/c10-5-1-4-3-12-7(11)2-6(4)13-8(5)9(14)15/h1-3H,(H,14,15).
What are the key properties of 3-bromo-7-chloro-1,6-naphthyridine-2-carboxylic acid?
3-bromo-7-chloro-1,6-naphthyridine-2-carboxylic acid has a molecular weight of 287.50 g/mol, XLogP of 2.74, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-7-chloro-1,6-naphthyridine-2-carboxylic acid is sourced from PubChem (CID 171555659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).