About 5-bromo-6-chloropyridine-3-carboxylic acid;hydrazine
5-bromo-6-chloropyridine-3-carboxylic acid;hydrazine (PubChem CID 174723335) has the molecular formula C6H7BrClN3O2
and a molecular weight of 268.50 g/mol. Its IUPAC name is 5-bromo-6-chloropyridine-3-carboxylic acid;hydrazine.
Molecular Properties
| Compound Name | 5-bromo-6-chloropyridine-3-carboxylic acid;hydrazine |
| PubChem CID | 174723335 |
| Molecular Formula | C6H7BrClN3O2 |
| Molecular Weight | 268.50 g/mol |
| Exact Mass | 266.94 |
| IUPAC Name | 5-bromo-6-chloropyridine-3-carboxylic acid;hydrazine |
| SMILES | NN.O=C(O)c1cnc(Cl)c(Br)c1 |
| InChI | InChI=1S/C6H3BrClNO2.H4N2/c7-4-1-3(6(10)11)2-9-5(4)8;1-2/h1-2H,(H,10,11);1-2H2 |
| InChIKey | KMBPRXBFGBXURZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.50 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-6-chloropyridine-3-carboxylic acid;hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-6-chloropyridine-3-carboxylic acid;hydrazine?
The IUPAC name of 5-bromo-6-chloropyridine-3-carboxylic acid;hydrazine (CID 174723335) is 5-bromo-6-chloropyridine-3-carboxylic acid;hydrazine.
What is the SMILES notation for 5-bromo-6-chloropyridine-3-carboxylic acid;hydrazine?
The canonical SMILES for 5-bromo-6-chloropyridine-3-carboxylic acid;hydrazine is NN.O=C(O)c1cnc(Cl)c(Br)c1.
What is the InChIKey of 5-bromo-6-chloropyridine-3-carboxylic acid;hydrazine?
The InChIKey is KMBPRXBFGBXURZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrClNO2.H4N2/c7-4-1-3(6(10)11)2-9-5(4)8;1-2/h1-2H,(H,10,11);1-2H2.
What are the key properties of 5-bromo-6-chloropyridine-3-carboxylic acid;hydrazine?
5-bromo-6-chloropyridine-3-carboxylic acid;hydrazine has a molecular weight of 268.50 g/mol, XLogP of 1.01, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-6-chloropyridine-3-carboxylic acid;hydrazine is sourced from PubChem (CID 174723335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).