C12H8BCl4N2O3 — CID 158860018
CID 158860018 (PubChem CID 158860018) has the molecular formula C12H8BCl4N2O3 and a molecular weight of 380.83 g/mol.
| Compound Name | CID 158860018 |
|---|---|
| PubChem CID | 158860018 |
| Molecular Formula | C12H8BCl4N2O3 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 378.94 |
| IUPAC Name | — |
| SMILES | O=C(O)c1cnc(Cl)c(Cl)c1.OCc1cnc(Cl)c(Cl)c1.[B] |
| InChI | InChI=1S/C6H3Cl2NO2.C6H5Cl2NO.B/c7-4-1-3(6(10)11)2-9-5(4)8;7-5-1-4(3-10)2-9-6(5)8;/h1-2H,(H,10,11);1-2,10H,3H2; |
| InChIKey | WBBXLHSOWYESGS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|