C11H14ClN3O3 — CID 123796335
4-[3-chloro-5-(hydroxymethyl)-2-pyridinyl]piperazine-1-carboxylic acid (PubChem CID 123796335) has the molecular formula C11H14ClN3O3 and a molecular weight of 271.70 g/mol. Its IUPAC name is 4-[3-chloro-5-(hydroxymethyl)-2-pyridinyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[3-chloro-5-(hydroxymethyl)-2-pyridinyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 123796335 |
| Molecular Formula | C11H14ClN3O3 |
| Molecular Weight | 271.70 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | 4-[3-chloro-5-(hydroxymethyl)-2-pyridinyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(c2ncc(CO)cc2Cl)CC1 |
| InChI | InChI=1S/C11H14ClN3O3/c12-9-5-8(7-16)6-13-10(9)14-1-3-15(4-2-14)11(17)18/h5-6,16H,1-4,7H2,(H,17,18) |
| InChIKey | JDQUHNWECAVHEU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 76.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.70 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |