C10H12Cl2N4O2 — CID 123681527
4-(6-amino-3,5-dichloro-2-pyridinyl)piperazine-1-carboxylic acid (PubChem CID 123681527) has the molecular formula C10H12Cl2N4O2 and a molecular weight of 291.14 g/mol. Its IUPAC name is 4-(6-amino-3,5-dichloro-2-pyridinyl)piperazine-1-carboxylic acid.
| Compound Name | 4-(6-amino-3,5-dichloro-2-pyridinyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 123681527 |
| Molecular Formula | C10H12Cl2N4O2 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 4-(6-amino-3,5-dichloro-2-pyridinyl)piperazine-1-carboxylic acid |
| SMILES | Nc1nc(N2CCN(C(=O)O)CC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H12Cl2N4O2/c11-6-5-7(12)9(14-8(6)13)15-1-3-16(4-2-15)10(17)18/h5H,1-4H2,(H2,13,14)(H,17,18) |
| InChIKey | YMFKETFRPWWFTF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |