C11H15Cl2N5O — CID 102762358
1-[4-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)piperazin-1-yl]ethanone (PubChem CID 102762358) has the molecular formula C11H15Cl2N5O and a molecular weight of 304.18 g/mol. Its IUPAC name is 1-[4-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 102762358 |
| Molecular Formula | C11H15Cl2N5O |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 1-[4-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2nc(NN)c(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C11H15Cl2N5O/c1-7(19)17-2-4-18(5-3-17)11-9(13)6-8(12)10(15-11)16-14/h6H,2-5,14H2,1H3,(H,15,16) |
| InChIKey | VXNIPBXRBCPVNH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|