C12H17Cl2N5O — CID 102761835
1-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-6-methylpiperidine-3-carboxamide (PubChem CID 102761835) has the molecular formula C12H17Cl2N5O and a molecular weight of 318.21 g/mol. Its IUPAC name is 1-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-6-methylpiperidine-3-carboxamide.
| Compound Name | 1-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 102761835 |
| Molecular Formula | C12H17Cl2N5O |
| Molecular Weight | 318.21 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 1-(3,5-dichloro-6-hydrazinyl-2-pyridinyl)-6-methylpiperidine-3-carboxamide |
| SMILES | CC1CCC(C(N)=O)CN1c1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H17Cl2N5O/c1-6-2-3-7(10(15)20)5-19(6)12-9(14)4-8(13)11(17-12)18-16/h4,6-7H,2-3,5,16H2,1H3,(H2,15,20)(H,17,18) |
| InChIKey | ZJWYHGUPAVAXSP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|